C14H20N2O5S2 — CID 54110613
4-[5-(ethylsulfonylamino)-1H-indol-3-yl]butane-1-sulfonic acid (PubChem CID 54110613) has the molecular formula C14H20N2O5S2 and a molecular weight of 360.46 g/mol. Its IUPAC name is 4-[5-(ethylsulfonylamino)-1H-indol-3-yl]butane-1-sulfonic acid.
| Compound Name | 4-[5-(ethylsulfonylamino)-1H-indol-3-yl]butane-1-sulfonic acid |
|---|---|
| PubChem CID | 54110613 |
| Molecular Formula | C14H20N2O5S2 |
| Molecular Weight | 360.46 g/mol |
| Exact Mass | 360.08 |
| IUPAC Name | 4-[5-(ethylsulfonylamino)-1H-indol-3-yl]butane-1-sulfonic acid |
| SMILES | CCS(=O)(=O)Nc1ccc2[nH]cc(CCCCS(=O)(=O)O)c2c1 |
| InChI | InChI=1S/C14H20N2O5S2/c1-2-22(17,18)16-12-6-7-14-13(9-12)11(10-15-14)5-3-4-8-23(19,20)21/h6-7,9-10,15-16H,2-5,8H2,1H3,(H,19,20,21) |
| InChIKey | NGVDYTCMQOFVBP-UHFFFAOYSA-N |
| XLogP | 2.14 |
| TPSA | 116.33 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.46 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|