About 3-[4-(4-fluorobenzoyl)piperidin-1-yl]propyl N-(2,3-dihydro-1H-indol-7-yl)carbamate
3-[4-(4-fluorobenzoyl)piperidin-1-yl]propyl N-(2,3-dihydro-1H-indol-7-yl)carbamate (PubChem CID 54110968) has the molecular formula C24H28FN3O3
and a molecular weight of 425.50 g/mol. Its IUPAC name is 3-[4-(4-fluorobenzoyl)piperidin-1-yl]propyl N-(2,3-dihydro-1H-indol-7-yl)carbamate.
Molecular Properties
| Compound Name | 3-[4-(4-fluorobenzoyl)piperidin-1-yl]propyl N-(2,3-dihydro-1H-indol-7-yl)carbamate |
| PubChem CID | 54110968 |
| Molecular Formula | C24H28FN3O3 |
| Molecular Weight | 425.50 g/mol |
| Exact Mass | 425.21 |
| IUPAC Name | 3-[4-(4-fluorobenzoyl)piperidin-1-yl]propyl N-(2,3-dihydro-1H-indol-7-yl)carbamate |
| SMILES | O=C(Nc1cccc2c1NCC2)OCCCN1CCC(C(=O)c2ccc(F)cc2)CC1 |
| InChI | InChI=1S/C24H28FN3O3/c25-20-7-5-18(6-8-20)23(29)19-10-14-28(15-11-19)13-2-16-31-24(30)27-21-4-1-3-17-9-12-26-22(17)21/h1,3-8,19,26H,2,9-16H2,(H,27,30) |
| InChIKey | NHBCFOHSJCYWDD-UHFFFAOYSA-N |
| XLogP | 4.33 |
| TPSA | 70.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 425.50 |
| LogP ≤ 5 | 4.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 3-[4-(4-fluorobenzoyl)piperidin-1-yl]propyl N-(2,3-dihydro-1H-indol-7-yl)carbamate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[4-(4-fluorobenzoyl)piperidin-1-yl]propyl N-(2,3-dihydro-1H-indol-7-yl)carbamate?
The IUPAC name of 3-[4-(4-fluorobenzoyl)piperidin-1-yl]propyl N-(2,3-dihydro-1H-indol-7-yl)carbamate (CID 54110968) is 3-[4-(4-fluorobenzoyl)piperidin-1-yl]propyl N-(2,3-dihydro-1H-indol-7-yl)carbamate.
What is the SMILES notation for 3-[4-(4-fluorobenzoyl)piperidin-1-yl]propyl N-(2,3-dihydro-1H-indol-7-yl)carbamate?
The canonical SMILES for 3-[4-(4-fluorobenzoyl)piperidin-1-yl]propyl N-(2,3-dihydro-1H-indol-7-yl)carbamate is O=C(Nc1cccc2c1NCC2)OCCCN1CCC(C(=O)c2ccc(F)cc2)CC1.
What is the InChIKey of 3-[4-(4-fluorobenzoyl)piperidin-1-yl]propyl N-(2,3-dihydro-1H-indol-7-yl)carbamate?
The InChIKey is NHBCFOHSJCYWDD-UHFFFAOYSA-N. The full InChI is InChI=1S/C24H28FN3O3/c25-20-7-5-18(6-8-20)23(29)19-10-14-28(15-11-19)13-2-16-31-24(30)27-21-4-1-3-17-9-12-26-22(17)21/h1,3-8,19,26H,2,9-16H2,(H,27,30).
What are the key properties of 3-[4-(4-fluorobenzoyl)piperidin-1-yl]propyl N-(2,3-dihydro-1H-indol-7-yl)carbamate?
3-[4-(4-fluorobenzoyl)piperidin-1-yl]propyl N-(2,3-dihydro-1H-indol-7-yl)carbamate has a molecular weight of 425.50 g/mol, XLogP of 4.33, 7 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[4-(4-fluorobenzoyl)piperidin-1-yl]propyl N-(2,3-dihydro-1H-indol-7-yl)carbamate is sourced from PubChem (CID 54110968), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).