C24H25FN2O4 — CID 54487038
3-[4-(4-fluorobenzoyl)piperidin-1-yl]propyl N-(1-benzofuran-4-yl)carbamate (PubChem CID 54487038) has the molecular formula C24H25FN2O4 and a molecular weight of 424.47 g/mol. Its IUPAC name is 3-[4-(4-fluorobenzoyl)piperidin-1-yl]propyl N-(1-benzofuran-4-yl)carbamate.
| Compound Name | 3-[4-(4-fluorobenzoyl)piperidin-1-yl]propyl N-(1-benzofuran-4-yl)carbamate |
|---|---|
| PubChem CID | 54487038 |
| Molecular Formula | C24H25FN2O4 |
| Molecular Weight | 424.47 g/mol |
| Exact Mass | 424.18 |
| IUPAC Name | 3-[4-(4-fluorobenzoyl)piperidin-1-yl]propyl N-(1-benzofuran-4-yl)carbamate |
| SMILES | O=C(Nc1cccc2occc12)OCCCN1CCC(C(=O)c2ccc(F)cc2)CC1 |
| InChI | InChI=1S/C24H25FN2O4/c25-19-7-5-17(6-8-19)23(28)18-9-13-27(14-10-18)12-2-15-31-24(29)26-21-3-1-4-22-20(21)11-16-30-22/h1,3-8,11,16,18H,2,9-10,12-15H2,(H,26,29) |
| InChIKey | XTAVSVOPUIYQFN-UHFFFAOYSA-N |
| XLogP | 5.11 |
| TPSA | 71.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.47 |
| LogP ≤ 5 | 5.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|