C25H26ClN3O3 — CID 67841973
3-[4-(4-chlorobenzoyl)piperidin-1-yl]propyl N-quinolin-5-ylcarbamate (PubChem CID 67841973) has the molecular formula C25H26ClN3O3 and a molecular weight of 451.95 g/mol. Its IUPAC name is 3-[4-(4-chlorobenzoyl)piperidin-1-yl]propyl N-quinolin-5-ylcarbamate.
| Compound Name | 3-[4-(4-chlorobenzoyl)piperidin-1-yl]propyl N-quinolin-5-ylcarbamate |
|---|---|
| PubChem CID | 67841973 |
| Molecular Formula | C25H26ClN3O3 |
| Molecular Weight | 451.95 g/mol |
| Exact Mass | 451.17 |
| IUPAC Name | 3-[4-(4-chlorobenzoyl)piperidin-1-yl]propyl N-quinolin-5-ylcarbamate |
| SMILES | O=C(Nc1cccc2ncccc12)OCCCN1CCC(C(=O)c2ccc(Cl)cc2)CC1 |
| InChI | InChI=1S/C25H26ClN3O3/c26-20-9-7-18(8-10-20)24(30)19-11-15-29(16-12-19)14-3-17-32-25(31)28-23-6-1-5-22-21(23)4-2-13-27-22/h1-2,4-10,13,19H,3,11-12,14-17H2,(H,28,31) |
| InChIKey | BSWLQECUNLDJKS-UHFFFAOYSA-N |
| XLogP | 5.42 |
| TPSA | 71.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.95 |
| LogP ≤ 5 | 5.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|