C18H25NO4 — CID 54111754
3-[4-[1-(2-aminoethyl)cyclohexanecarbonyl]oxyphenyl]propanoic acid (PubChem CID 54111754) has the molecular formula C18H25NO4 and a molecular weight of 319.40 g/mol. Its IUPAC name is 3-[4-[1-(2-aminoethyl)cyclohexanecarbonyl]oxyphenyl]propanoic acid.
| Compound Name | 3-[4-[1-(2-aminoethyl)cyclohexanecarbonyl]oxyphenyl]propanoic acid |
|---|---|
| PubChem CID | 54111754 |
| Molecular Formula | C18H25NO4 |
| Molecular Weight | 319.40 g/mol |
| Exact Mass | 319.18 |
| IUPAC Name | 3-[4-[1-(2-aminoethyl)cyclohexanecarbonyl]oxyphenyl]propanoic acid |
| SMILES | NCCC1(C(=O)Oc2ccc(CCC(=O)O)cc2)CCCCC1 |
| InChI | InChI=1S/C18H25NO4/c19-13-12-18(10-2-1-3-11-18)17(22)23-15-7-4-14(5-8-15)6-9-16(20)21/h4-5,7-8H,1-3,6,9-13,19H2,(H,20,21) |
| InChIKey | NHPQHCJHXBJTTM-UHFFFAOYSA-N |
| XLogP | 2.91 |
| TPSA | 89.62 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.40 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|