C17H22F3NO4 — CID 54754304
phenyl 1-[2-(methylamino)ethyl]cyclopentane-1-carboxylate;2,2,2-trifluoroacetic acid (PubChem CID 54754304) has the molecular formula C17H22F3NO4 and a molecular weight of 361.36 g/mol. Its IUPAC name is phenyl 1-[2-(methylamino)ethyl]cyclopentane-1-carboxylate;2,2,2-trifluoroacetic acid.
| Compound Name | phenyl 1-[2-(methylamino)ethyl]cyclopentane-1-carboxylate;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 54754304 |
| Molecular Formula | C17H22F3NO4 |
| Molecular Weight | 361.36 g/mol |
| Exact Mass | 361.15 |
| IUPAC Name | phenyl 1-[2-(methylamino)ethyl]cyclopentane-1-carboxylate;2,2,2-trifluoroacetic acid |
| SMILES | CNCCC1(C(=O)Oc2ccccc2)CCCC1.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C15H21NO2.C2HF3O2/c1-16-12-11-15(9-5-6-10-15)14(17)18-13-7-3-2-4-8-13;3-2(4,5)1(6)7/h2-4,7-8,16H,5-6,9-12H2,1H3;(H,6,7) |
| InChIKey | YKCGCNMAJMAJEP-UHFFFAOYSA-N |
| XLogP | 3.40 |
| TPSA | 75.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.36 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|