C33H28N2O4 — CID 54112218
2-[7-methoxy-2-(2-phenylpropyl)-1H-benzimidazol-4-yl]-5-phenylmethoxyindene-1,3-dione (PubChem CID 54112218) has the molecular formula C33H28N2O4 and a molecular weight of 516.60 g/mol. Its IUPAC name is 2-[7-methoxy-2-(2-phenylpropyl)-1H-benzimidazol-4-yl]-5-phenylmethoxyindene-1,3-dione.
| Compound Name | 2-[7-methoxy-2-(2-phenylpropyl)-1H-benzimidazol-4-yl]-5-phenylmethoxyindene-1,3-dione |
|---|---|
| PubChem CID | 54112218 |
| Molecular Formula | C33H28N2O4 |
| Molecular Weight | 516.60 g/mol |
| Exact Mass | 516.20 |
| IUPAC Name | 2-[7-methoxy-2-(2-phenylpropyl)-1H-benzimidazol-4-yl]-5-phenylmethoxyindene-1,3-dione |
| SMILES | COc1ccc(C2C(=O)c3ccc(OCc4ccccc4)cc3C2=O)c2nc(CC(C)c3ccccc3)[nH]c12 |
| InChI | InChI=1S/C33H28N2O4/c1-20(22-11-7-4-8-12-22)17-28-34-30-25(15-16-27(38-2)31(30)35-28)29-32(36)24-14-13-23(18-26(24)33(29)37)39-19-21-9-5-3-6-10-21/h3-16,18,20,29H,17,19H2,1-2H3,(H,34,35) |
| InChIKey | NHXGTQGFOKDIRL-UHFFFAOYSA-N |
| XLogP | 6.66 |
| TPSA | 81.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 516.60 |
| LogP ≤ 5 | 6.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'keto_keto_beta_A(68)', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|