C34H30N2O5 — CID 67627878
2-[7-methoxy-2-(3-methoxy-1-phenylpropyl)-1H-benzimidazol-4-yl]-5-phenylmethoxyindene-1,3-dione (PubChem CID 67627878) has the molecular formula C34H30N2O5 and a molecular weight of 546.62 g/mol. Its IUPAC name is 2-[7-methoxy-2-(3-methoxy-1-phenylpropyl)-1H-benzimidazol-4-yl]-5-phenylmethoxyindene-1,3-dione.
| Compound Name | 2-[7-methoxy-2-(3-methoxy-1-phenylpropyl)-1H-benzimidazol-4-yl]-5-phenylmethoxyindene-1,3-dione |
|---|---|
| PubChem CID | 67627878 |
| Molecular Formula | C34H30N2O5 |
| Molecular Weight | 546.62 g/mol |
| Exact Mass | 546.22 |
| IUPAC Name | 2-[7-methoxy-2-(3-methoxy-1-phenylpropyl)-1H-benzimidazol-4-yl]-5-phenylmethoxyindene-1,3-dione |
| SMILES | COCCC(c1ccccc1)c1nc2c(C3C(=O)c4ccc(OCc5ccccc5)cc4C3=O)ccc(OC)c2[nH]1 |
| InChI | InChI=1S/C34H30N2O5/c1-39-18-17-24(22-11-7-4-8-12-22)34-35-30-26(15-16-28(40-2)31(30)36-34)29-32(37)25-14-13-23(19-27(25)33(29)38)41-20-21-9-5-3-6-10-21/h3-16,19,24,29H,17-18,20H2,1-2H3,(H,35,36) |
| InChIKey | OOBCIOUVJHZEJX-UHFFFAOYSA-N |
| XLogP | 6.48 |
| TPSA | 90.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 546.62 |
| LogP ≤ 5 | 6.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'keto_keto_beta_A(68)', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|