C24H22N2O3 — CID 22663242
methyl 2-(1,2-diphenylethyl)-7-methoxy-1H-benzimidazole-4-carboxylate (PubChem CID 22663242) has the molecular formula C24H22N2O3 and a molecular weight of 386.45 g/mol. Its IUPAC name is methyl 2-(1,2-diphenylethyl)-7-methoxy-1H-benzimidazole-4-carboxylate.
| Compound Name | methyl 2-(1,2-diphenylethyl)-7-methoxy-1H-benzimidazole-4-carboxylate |
|---|---|
| PubChem CID | 22663242 |
| Molecular Formula | C24H22N2O3 |
| Molecular Weight | 386.45 g/mol |
| Exact Mass | 386.16 |
| IUPAC Name | methyl 2-(1,2-diphenylethyl)-7-methoxy-1H-benzimidazole-4-carboxylate |
| SMILES | COC(=O)c1ccc(OC)c2[nH]c(C(Cc3ccccc3)c3ccccc3)nc12 |
| InChI | InChI=1S/C24H22N2O3/c1-28-20-14-13-18(24(27)29-2)21-22(20)26-23(25-21)19(17-11-7-4-8-12-17)15-16-9-5-3-6-10-16/h3-14,19H,15H2,1-2H3,(H,25,26) |
| InChIKey | SIEWBNBYXYJWEY-UHFFFAOYSA-N |
| XLogP | 4.73 |
| TPSA | 64.21 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.45 |
| LogP ≤ 5 | 4.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |