C13H16N2O3 — CID 22663368
methyl 7-methoxy-2-propan-2-yl-1H-benzimidazole-4-carboxylate (PubChem CID 22663368) has the molecular formula C13H16N2O3 and a molecular weight of 248.28 g/mol. Its IUPAC name is methyl 7-methoxy-2-propan-2-yl-1H-benzimidazole-4-carboxylate.
| Compound Name | methyl 7-methoxy-2-propan-2-yl-1H-benzimidazole-4-carboxylate |
|---|---|
| PubChem CID | 22663368 |
| Molecular Formula | C13H16N2O3 |
| Molecular Weight | 248.28 g/mol |
| Exact Mass | 248.12 |
| IUPAC Name | methyl 7-methoxy-2-propan-2-yl-1H-benzimidazole-4-carboxylate |
| SMILES | COC(=O)c1ccc(OC)c2[nH]c(C(C)C)nc12 |
| InChI | InChI=1S/C13H16N2O3/c1-7(2)12-14-10-8(13(16)18-4)5-6-9(17-3)11(10)15-12/h5-7H,1-4H3,(H,14,15) |
| InChIKey | YTDXJWCQCKMDGM-UHFFFAOYSA-N |
| XLogP | 2.48 |
| TPSA | 64.21 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.28 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |