C18H18N2O5 — CID 22663333
methyl 7-methoxy-2-[(2-methoxyphenoxy)methyl]-1H-benzimidazole-4-carboxylate (PubChem CID 22663333) has the molecular formula C18H18N2O5 and a molecular weight of 342.35 g/mol. Its IUPAC name is methyl 7-methoxy-2-[(2-methoxyphenoxy)methyl]-1H-benzimidazole-4-carboxylate.
| Compound Name | methyl 7-methoxy-2-[(2-methoxyphenoxy)methyl]-1H-benzimidazole-4-carboxylate |
|---|---|
| PubChem CID | 22663333 |
| Molecular Formula | C18H18N2O5 |
| Molecular Weight | 342.35 g/mol |
| Exact Mass | 342.12 |
| IUPAC Name | methyl 7-methoxy-2-[(2-methoxyphenoxy)methyl]-1H-benzimidazole-4-carboxylate |
| SMILES | COC(=O)c1ccc(OC)c2[nH]c(COc3ccccc3OC)nc12 |
| InChI | InChI=1S/C18H18N2O5/c1-22-12-6-4-5-7-13(12)25-10-15-19-16-11(18(21)24-3)8-9-14(23-2)17(16)20-15/h4-9H,10H2,1-3H3,(H,19,20) |
| InChIKey | VSAYWBFCSJVYCY-UHFFFAOYSA-N |
| XLogP | 2.95 |
| TPSA | 82.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.35 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |