C17H16N2O3 — CID 22663413
7-methoxy-2-(1-phenylethyl)-1H-benzimidazole-4-carboxylic acid (PubChem CID 22663413) has the molecular formula C17H16N2O3 and a molecular weight of 296.33 g/mol. Its IUPAC name is 7-methoxy-2-(1-phenylethyl)-1H-benzimidazole-4-carboxylic acid.
| Compound Name | 7-methoxy-2-(1-phenylethyl)-1H-benzimidazole-4-carboxylic acid |
|---|---|
| PubChem CID | 22663413 |
| Molecular Formula | C17H16N2O3 |
| Molecular Weight | 296.33 g/mol |
| Exact Mass | 296.12 |
| IUPAC Name | 7-methoxy-2-(1-phenylethyl)-1H-benzimidazole-4-carboxylic acid |
| SMILES | COc1ccc(C(=O)O)c2nc(C(C)c3ccccc3)[nH]c12 |
| InChI | InChI=1S/C17H16N2O3/c1-10(11-6-4-3-5-7-11)16-18-14-12(17(20)21)8-9-13(22-2)15(14)19-16/h3-10H,1-2H3,(H,18,19)(H,20,21) |
| InChIKey | FQRVCSIJXRPEFF-UHFFFAOYSA-N |
| XLogP | 3.42 |
| TPSA | 75.21 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.33 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |