C40H35N3O4 — CID 54212678
2-[7-methoxy-2-(1-phenylbutyl)-1H-benzimidazol-4-yl]-5-phenylmethoxy-2-(pyridin-4-ylmethyl)indene-1,3-dione (PubChem CID 54212678) has the molecular formula C40H35N3O4 and a molecular weight of 621.74 g/mol. Its IUPAC name is 2-[7-methoxy-2-(1-phenylbutyl)-1H-benzimidazol-4-yl]-5-phenylmethoxy-2-(pyridin-4-ylmethyl)indene-1,3-dione.
| Compound Name | 2-[7-methoxy-2-(1-phenylbutyl)-1H-benzimidazol-4-yl]-5-phenylmethoxy-2-(pyridin-4-ylmethyl)indene-1,3-dione |
|---|---|
| PubChem CID | 54212678 |
| Molecular Formula | C40H35N3O4 |
| Molecular Weight | 621.74 g/mol |
| Exact Mass | 621.26 |
| IUPAC Name | 2-[7-methoxy-2-(1-phenylbutyl)-1H-benzimidazol-4-yl]-5-phenylmethoxy-2-(pyridin-4-ylmethyl)indene-1,3-dione |
| SMILES | CCCC(c1ccccc1)c1nc2c(C3(Cc4ccncc4)C(=O)c4ccc(OCc5ccccc5)cc4C3=O)ccc(OC)c2[nH]1 |
| InChI | InChI=1S/C40H35N3O4/c1-3-10-30(28-13-8-5-9-14-28)39-42-35-33(17-18-34(46-2)36(35)43-39)40(24-26-19-21-41-22-20-26)37(44)31-16-15-29(23-32(31)38(40)45)47-25-27-11-6-4-7-12-27/h4-9,11-23,30H,3,10,24-25H2,1-2H3,(H,42,43) |
| InChIKey | PXAHTATZYDJOQN-UHFFFAOYSA-N |
| XLogP | 8.04 |
| TPSA | 94.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 621.74 |
| LogP ≤ 5 | 8.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'keto_keto_beta_A(68)', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|