C34H31NO5 — CID 10768631
(2R)-2-(3-cyclopentyloxy-4-methoxyphenyl)-5-phenylmethoxy-2-(pyridin-4-ylmethyl)indene-1,3-dione (PubChem CID 10768631) has the molecular formula C34H31NO5 and a molecular weight of 533.62 g/mol. Its IUPAC name is (2R)-2-(3-cyclopentyloxy-4-methoxyphenyl)-5-phenylmethoxy-2-(pyridin-4-ylmethyl)indene-1,3-dione.
| Compound Name | (2R)-2-(3-cyclopentyloxy-4-methoxyphenyl)-5-phenylmethoxy-2-(pyridin-4-ylmethyl)indene-1,3-dione |
|---|---|
| PubChem CID | 10768631 |
| Molecular Formula | C34H31NO5 |
| Molecular Weight | 533.62 g/mol |
| Exact Mass | 533.22 |
| IUPAC Name | (2R)-2-(3-cyclopentyloxy-4-methoxyphenyl)-5-phenylmethoxy-2-(pyridin-4-ylmethyl)indene-1,3-dione |
| SMILES | COc1ccc([C@]2(Cc3ccncc3)C(=O)c3ccc(OCc4ccccc4)cc3C2=O)cc1OC1CCCC1 |
| InChI | InChI=1S/C34H31NO5/c1-38-30-14-11-25(19-31(30)40-26-9-5-6-10-26)34(21-23-15-17-35-18-16-23)32(36)28-13-12-27(20-29(28)33(34)37)39-22-24-7-3-2-4-8-24/h2-4,7-8,11-20,26H,5-6,9-10,21-22H2,1H3/t34-/m1/s1 |
| InChIKey | OGBJRNXYVDSUAD-UUWRZZSWSA-N |
| XLogP | 6.55 |
| TPSA | 74.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 533.62 |
| LogP ≤ 5 | 6.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'keto_keto_beta_A(68)', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|