C25H26O6 — CID 67628934
4-[2-(3-cyclopentyloxy-4-methoxyphenyl)-1,3-dioxoinden-2-yl]butanoic acid (PubChem CID 67628934) has the molecular formula C25H26O6 and a molecular weight of 422.48 g/mol. Its IUPAC name is 4-[2-(3-cyclopentyloxy-4-methoxyphenyl)-1,3-dioxoinden-2-yl]butanoic acid.
| Compound Name | 4-[2-(3-cyclopentyloxy-4-methoxyphenyl)-1,3-dioxoinden-2-yl]butanoic acid |
|---|---|
| PubChem CID | 67628934 |
| Molecular Formula | C25H26O6 |
| Molecular Weight | 422.48 g/mol |
| Exact Mass | 422.17 |
| IUPAC Name | 4-[2-(3-cyclopentyloxy-4-methoxyphenyl)-1,3-dioxoinden-2-yl]butanoic acid |
| SMILES | COc1ccc(C2(CCCC(=O)O)C(=O)c3ccccc3C2=O)cc1OC1CCCC1 |
| InChI | InChI=1S/C25H26O6/c1-30-20-13-12-16(15-21(20)31-17-7-2-3-8-17)25(14-6-11-22(26)27)23(28)18-9-4-5-10-19(18)24(25)29/h4-5,9-10,12-13,15,17H,2-3,6-8,11,14H2,1H3,(H,26,27) |
| InChIKey | XSNMJTGQCZBMNV-UHFFFAOYSA-N |
| XLogP | 4.59 |
| TPSA | 89.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.48 |
| LogP ≤ 5 | 4.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'keto_keto_beta_A(68)', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|