C34H31NO6 — CID 67637368
2-(3-cyclopentyloxy-4-methoxyphenyl)-2-[(1-oxidopyridin-1-ium-4-yl)methyl]-5-phenylmethoxyindene-1,3-dione (PubChem CID 67637368) has the molecular formula C34H31NO6 and a molecular weight of 549.62 g/mol. Its IUPAC name is 2-(3-cyclopentyloxy-4-methoxyphenyl)-2-[(1-oxidopyridin-1-ium-4-yl)methyl]-5-phenylmethoxyindene-1,3-dione.
| Compound Name | 2-(3-cyclopentyloxy-4-methoxyphenyl)-2-[(1-oxidopyridin-1-ium-4-yl)methyl]-5-phenylmethoxyindene-1,3-dione |
|---|---|
| PubChem CID | 67637368 |
| Molecular Formula | C34H31NO6 |
| Molecular Weight | 549.62 g/mol |
| Exact Mass | 549.22 |
| IUPAC Name | 2-(3-cyclopentyloxy-4-methoxyphenyl)-2-[(1-oxidopyridin-1-ium-4-yl)methyl]-5-phenylmethoxyindene-1,3-dione |
| SMILES | COc1ccc(C2(Cc3cc[n+]([O-])cc3)C(=O)c3ccc(OCc4ccccc4)cc3C2=O)cc1OC1CCCC1 |
| InChI | InChI=1S/C34H31NO6/c1-39-30-14-11-25(19-31(30)41-26-9-5-6-10-26)34(21-23-15-17-35(38)18-16-23)32(36)28-13-12-27(20-29(28)33(34)37)40-22-24-7-3-2-4-8-24/h2-4,7-8,11-20,26H,5-6,9-10,21-22H2,1H3 |
| InChIKey | WZEISDJXJLPNHR-UHFFFAOYSA-N |
| XLogP | 5.79 |
| TPSA | 88.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 549.62 |
| LogP ≤ 5 | 5.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'keto_keto_beta_A(68)', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'N_oxide', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|