C23H18O3 — CID 56689373
2-[(4-methoxyphenyl)methyl]-2-phenylindene-1,3-dione (PubChem CID 56689373) has the molecular formula C23H18O3 and a molecular weight of 342.39 g/mol. Its IUPAC name is 2-[(4-methoxyphenyl)methyl]-2-phenylindene-1,3-dione.
| Compound Name | 2-[(4-methoxyphenyl)methyl]-2-phenylindene-1,3-dione |
|---|---|
| PubChem CID | 56689373 |
| Molecular Formula | C23H18O3 |
| Molecular Weight | 342.39 g/mol |
| Exact Mass | 342.13 |
| IUPAC Name | 2-[(4-methoxyphenyl)methyl]-2-phenylindene-1,3-dione |
| SMILES | COc1ccc(CC2(c3ccccc3)C(=O)c3ccccc3C2=O)cc1 |
| InChI | InChI=1S/C23H18O3/c1-26-18-13-11-16(12-14-18)15-23(17-7-3-2-4-8-17)21(24)19-9-5-6-10-20(19)22(23)25/h2-14H,15H2,1H3 |
| InChIKey | PXQBUZKDVQPEOV-UHFFFAOYSA-N |
| XLogP | 4.25 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.39 |
| LogP ≤ 5 | 4.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'keto_keto_beta_A(68)', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|