C24H17BrO3 — CID 10788893
(1R,1aR,7aR)-1a-bromo-1-(4-methoxyphenyl)-1-phenyl-7aH-cyclopropa[b]naphthalene-2,7-dione (PubChem CID 10788893) has the molecular formula C24H17BrO3 and a molecular weight of 433.30 g/mol. Its IUPAC name is (1R,1aR,7aR)-1a-bromo-1-(4-methoxyphenyl)-1-phenyl-7aH-cyclopropa[b]naphthalene-2,7-dione.
| Compound Name | (1R,1aR,7aR)-1a-bromo-1-(4-methoxyphenyl)-1-phenyl-7aH-cyclopropa[b]naphthalene-2,7-dione |
|---|---|
| PubChem CID | 10788893 |
| Molecular Formula | C24H17BrO3 |
| Molecular Weight | 433.30 g/mol |
| Exact Mass | 432.04 |
| IUPAC Name | (1R,1aR,7aR)-1a-bromo-1-(4-methoxyphenyl)-1-phenyl-7aH-cyclopropa[b]naphthalene-2,7-dione |
| SMILES | COc1ccc([C@]2(c3ccccc3)[C@@H]3C(=O)c4ccccc4C(=O)[C@@]32Br)cc1 |
| InChI | InChI=1S/C24H17BrO3/c1-28-17-13-11-16(12-14-17)23(15-7-3-2-4-8-15)21-20(26)18-9-5-6-10-19(18)22(27)24(21,23)25/h2-14,21H,1H3/t21-,23+,24-/m0/s1 |
| InChIKey | JYHMSTVDQYMXBD-QTJGBDASSA-N |
| XLogP | 4.82 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.30 |
| LogP ≤ 5 | 4.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'keto_keto_gamma(5)', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|