C22H18O4Se — CID 10251803
2,2-bis(4-methoxyphenyl)-3,1-benzoxaselenin-4-one (PubChem CID 10251803) has the molecular formula C22H18O4Se and a molecular weight of 425.34 g/mol. Its IUPAC name is 2,2-bis(4-methoxyphenyl)-3,1-benzoxaselenin-4-one.
| Compound Name | 2,2-bis(4-methoxyphenyl)-3,1-benzoxaselenin-4-one |
|---|---|
| PubChem CID | 10251803 |
| Molecular Formula | C22H18O4Se |
| Molecular Weight | 425.34 g/mol |
| Exact Mass | 426.04 |
| IUPAC Name | 2,2-bis(4-methoxyphenyl)-3,1-benzoxaselenin-4-one |
| SMILES | COc1ccc(C2(c3ccc(OC)cc3)OC(=O)c3ccccc3[Se]2)cc1 |
| InChI | InChI=1S/C22H18O4Se/c1-24-17-11-7-15(8-12-17)22(16-9-13-18(25-2)14-10-16)26-21(23)19-5-3-4-6-20(19)27-22/h3-14H,1-2H3 |
| InChIKey | JRVFQMDJESJPOO-UHFFFAOYSA-N |
| XLogP | 3.11 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.34 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|