C22H16FNO3 — CID 22432792
2-(4-fluoroanilino)-2-(4-methoxyphenyl)indene-1,3-dione (PubChem CID 22432792) has the molecular formula C22H16FNO3 and a molecular weight of 361.37 g/mol. Its IUPAC name is 2-(4-fluoroanilino)-2-(4-methoxyphenyl)indene-1,3-dione.
| Compound Name | 2-(4-fluoroanilino)-2-(4-methoxyphenyl)indene-1,3-dione |
|---|---|
| PubChem CID | 22432792 |
| Molecular Formula | C22H16FNO3 |
| Molecular Weight | 361.37 g/mol |
| Exact Mass | 361.11 |
| IUPAC Name | 2-(4-fluoroanilino)-2-(4-methoxyphenyl)indene-1,3-dione |
| SMILES | COc1ccc(C2(Nc3ccc(F)cc3)C(=O)c3ccccc3C2=O)cc1 |
| InChI | InChI=1S/C22H16FNO3/c1-27-17-12-6-14(7-13-17)22(24-16-10-8-15(23)9-11-16)20(25)18-4-2-3-5-19(18)21(22)26/h2-13,24H,1H3 |
| InChIKey | HDJYONAXFBVOTC-UHFFFAOYSA-N |
| XLogP | 4.22 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.37 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'keto_keto_beta_A(68)', 'substructure': 'N/A'}, {'alert_name': 'anil_alk_C(1)', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|