C27H18ClNO3 — CID 3108917
2-[4-(4-chlorophenoxy)anilino]-2-phenylindene-1,3-dione (PubChem CID 3108917) has the molecular formula C27H18ClNO3 and a molecular weight of 439.90 g/mol. Its IUPAC name is 2-[4-(4-chlorophenoxy)anilino]-2-phenylindene-1,3-dione.
| Compound Name | 2-[4-(4-chlorophenoxy)anilino]-2-phenylindene-1,3-dione |
|---|---|
| PubChem CID | 3108917 |
| Molecular Formula | C27H18ClNO3 |
| Molecular Weight | 439.90 g/mol |
| Exact Mass | 439.10 |
| IUPAC Name | 2-[4-(4-chlorophenoxy)anilino]-2-phenylindene-1,3-dione |
| SMILES | O=C1c2ccccc2C(=O)C1(Nc1ccc(Oc2ccc(Cl)cc2)cc1)c1ccccc1 |
| InChI | InChI=1S/C27H18ClNO3/c28-19-10-14-21(15-11-19)32-22-16-12-20(13-17-22)29-27(18-6-2-1-3-7-18)25(30)23-8-4-5-9-24(23)26(27)31/h1-17,29H |
| InChIKey | ZQBDDHFUMYSWGB-UHFFFAOYSA-N |
| XLogP | 6.52 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.90 |
| LogP ≤ 5 | 6.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'keto_keto_beta_A(68)', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|