C24H19NO4 — CID 2849350
N-[2-(4-methoxyphenyl)-1,3-dioxoinden-2-yl]-N-phenylacetamide (PubChem CID 2849350) has the molecular formula C24H19NO4 and a molecular weight of 385.42 g/mol. Its IUPAC name is N-[2-(4-methoxyphenyl)-1,3-dioxoinden-2-yl]-N-phenylacetamide.
| Compound Name | N-[2-(4-methoxyphenyl)-1,3-dioxoinden-2-yl]-N-phenylacetamide |
|---|---|
| PubChem CID | 2849350 |
| Molecular Formula | C24H19NO4 |
| Molecular Weight | 385.42 g/mol |
| Exact Mass | 385.13 |
| IUPAC Name | N-[2-(4-methoxyphenyl)-1,3-dioxoinden-2-yl]-N-phenylacetamide |
| SMILES | COc1ccc(C2(N(C(C)=O)c3ccccc3)C(=O)c3ccccc3C2=O)cc1 |
| InChI | InChI=1S/C24H19NO4/c1-16(26)25(18-8-4-3-5-9-18)24(17-12-14-19(29-2)15-13-17)22(27)20-10-6-7-11-21(20)23(24)28/h3-15H,1-2H3 |
| InChIKey | HBTGRKMEUCKRQY-UHFFFAOYSA-N |
| XLogP | 4.02 |
| TPSA | 63.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.42 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'keto_keto_beta_A(68)', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|