About 1-(4-methoxyphenyl)-N,2-dimethyl-N-(2-phenylphenyl)cyclopropane-1-carboxamide
1-(4-methoxyphenyl)-N,2-dimethyl-N-(2-phenylphenyl)cyclopropane-1-carboxamide (PubChem CID 67628200) has the molecular formula C25H25NO2
and a molecular weight of 371.48 g/mol. Its IUPAC name is 1-(4-methoxyphenyl)-N,2-dimethyl-N-(2-phenylphenyl)cyclopropane-1-carboxamide.
Molecular Properties
| Compound Name | 1-(4-methoxyphenyl)-N,2-dimethyl-N-(2-phenylphenyl)cyclopropane-1-carboxamide |
| PubChem CID | 67628200 |
| Molecular Formula | C25H25NO2 |
| Molecular Weight | 371.48 g/mol |
| Exact Mass | 371.19 |
| IUPAC Name | 1-(4-methoxyphenyl)-N,2-dimethyl-N-(2-phenylphenyl)cyclopropane-1-carboxamide |
| SMILES | COc1ccc(C2(C(=O)N(C)c3ccccc3-c3ccccc3)CC2C)cc1 |
| InChI | InChI=1S/C25H25NO2/c1-18-17-25(18,20-13-15-21(28-3)16-14-20)24(27)26(2)23-12-8-7-11-22(23)19-9-5-4-6-10-19/h4-16,18H,17H2,1-3H3 |
| InChIKey | SEPYSZMIRZLUJG-UHFFFAOYSA-N |
| XLogP | 5.30 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 371.48 |
| LogP ≤ 5 | 5.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 1-(4-methoxyphenyl)-N,2-dimethyl-N-(2-phenylphenyl)cyclopropane-1-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(4-methoxyphenyl)-N,2-dimethyl-N-(2-phenylphenyl)cyclopropane-1-carboxamide?
The IUPAC name of 1-(4-methoxyphenyl)-N,2-dimethyl-N-(2-phenylphenyl)cyclopropane-1-carboxamide (CID 67628200) is 1-(4-methoxyphenyl)-N,2-dimethyl-N-(2-phenylphenyl)cyclopropane-1-carboxamide.
What is the SMILES notation for 1-(4-methoxyphenyl)-N,2-dimethyl-N-(2-phenylphenyl)cyclopropane-1-carboxamide?
The canonical SMILES for 1-(4-methoxyphenyl)-N,2-dimethyl-N-(2-phenylphenyl)cyclopropane-1-carboxamide is COc1ccc(C2(C(=O)N(C)c3ccccc3-c3ccccc3)CC2C)cc1.
What is the InChIKey of 1-(4-methoxyphenyl)-N,2-dimethyl-N-(2-phenylphenyl)cyclopropane-1-carboxamide?
The InChIKey is SEPYSZMIRZLUJG-UHFFFAOYSA-N. The full InChI is InChI=1S/C25H25NO2/c1-18-17-25(18,20-13-15-21(28-3)16-14-20)24(27)26(2)23-12-8-7-11-22(23)19-9-5-4-6-10-19/h4-16,18H,17H2,1-3H3.
What are the key properties of 1-(4-methoxyphenyl)-N,2-dimethyl-N-(2-phenylphenyl)cyclopropane-1-carboxamide?
1-(4-methoxyphenyl)-N,2-dimethyl-N-(2-phenylphenyl)cyclopropane-1-carboxamide has a molecular weight of 371.48 g/mol, XLogP of 5.30, 5 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(4-methoxyphenyl)-N,2-dimethyl-N-(2-phenylphenyl)cyclopropane-1-carboxamide is sourced from PubChem (CID 67628200), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).