C12H14Cl2N4O — CID 54112305
trans-(1R,3R)-N-(diaminomethylidene)-3-(2,5-dichloro-3-pyridinyl)-2,2-dimethylcyclopropane-1-carboxamide (PubChem CID 54112305) has the molecular formula C12H14Cl2N4O and a molecular weight of 301.18 g/mol. Its IUPAC name is trans-(1R,3R)-N-(diaminomethylidene)-3-(2,5-dichloro-3-pyridinyl)-2,2-dimethylcyclopropane-1-carboxamide.
| Compound Name | trans-(1R,3R)-N-(diaminomethylidene)-3-(2,5-dichloro-3-pyridinyl)-2,2-dimethylcyclopropane-1-carboxamide |
|---|---|
| PubChem CID | 54112305 |
| Molecular Formula | C12H14Cl2N4O |
| Molecular Weight | 301.18 g/mol |
| Exact Mass | 300.05 |
| IUPAC Name | trans-(1R,3R)-N-(diaminomethylidene)-3-(2,5-dichloro-3-pyridinyl)-2,2-dimethylcyclopropane-1-carboxamide |
| SMILES | CC1(C)[C@H](C(=O)N=C(N)N)[C@H]1c1cc(Cl)cnc1Cl |
| InChI | InChI=1S/C12H14Cl2N4O/c1-12(2)7(8(12)10(19)18-11(15)16)6-3-5(13)4-17-9(6)14/h3-4,7-8H,1-2H3,(H4,15,16,18,19)/t7-,8+/m1/s1 |
| InChIKey | NHYMBMVEJHMWAI-SFYZADRCSA-N |
| XLogP | 1.93 |
| TPSA | 94.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.18 |
| LogP ≤ 5 | 1.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|