C12H14ClN3O2 — CID 146028620
4-(3-chlorophenyl)-N-(diaminomethylidene)oxolane-3-carboxamide (PubChem CID 146028620) has the molecular formula C12H14ClN3O2 and a molecular weight of 267.72 g/mol. Its IUPAC name is 4-(3-chlorophenyl)-N-(diaminomethylidene)oxolane-3-carboxamide.
| Compound Name | 4-(3-chlorophenyl)-N-(diaminomethylidene)oxolane-3-carboxamide |
|---|---|
| PubChem CID | 146028620 |
| Molecular Formula | C12H14ClN3O2 |
| Molecular Weight | 267.72 g/mol |
| Exact Mass | 267.08 |
| IUPAC Name | 4-(3-chlorophenyl)-N-(diaminomethylidene)oxolane-3-carboxamide |
| SMILES | NC(N)=NC(=O)C1COCC1c1cccc(Cl)c1 |
| InChI | InChI=1S/C12H14ClN3O2/c13-8-3-1-2-7(4-8)9-5-18-6-10(9)11(17)16-12(14)15/h1-4,9-10H,5-6H2,(H4,14,15,16,17) |
| InChIKey | QBBQNPUTUKGKSB-UHFFFAOYSA-N |
| XLogP | 0.87 |
| TPSA | 90.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.72 |
| LogP ≤ 5 | 0.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|