C13H16Cl2N2O2 — CID 54114932
1-[2-(3,5-dichlorophenyl)propan-2-yl]-3-prop-2-enoxyurea (PubChem CID 54114932) has the molecular formula C13H16Cl2N2O2 and a molecular weight of 303.19 g/mol. Its IUPAC name is 1-[2-(3,5-dichlorophenyl)propan-2-yl]-3-prop-2-enoxyurea.
| Compound Name | 1-[2-(3,5-dichlorophenyl)propan-2-yl]-3-prop-2-enoxyurea |
|---|---|
| PubChem CID | 54114932 |
| Molecular Formula | C13H16Cl2N2O2 |
| Molecular Weight | 303.19 g/mol |
| Exact Mass | 302.06 |
| IUPAC Name | 1-[2-(3,5-dichlorophenyl)propan-2-yl]-3-prop-2-enoxyurea |
| SMILES | C=CCONC(=O)NC(C)(C)c1cc(Cl)cc(Cl)c1 |
| InChI | InChI=1S/C13H16Cl2N2O2/c1-4-5-19-17-12(18)16-13(2,3)9-6-10(14)8-11(15)7-9/h4,6-8H,1,5H2,2-3H3,(H2,16,17,18) |
| InChIKey | NJRKLDGNQOTIGN-UHFFFAOYSA-N |
| XLogP | 3.65 |
| TPSA | 50.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.19 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|