C31H37N3O3 — CID 54119037
1-(4-benzhydrylpiperazin-1-yl)-3-[(6-methoxyimino-7,8-dihydro-5H-naphthalen-1-yl)oxy]propan-2-ol (PubChem CID 54119037) has the molecular formula C31H37N3O3 and a molecular weight of 499.66 g/mol. Its IUPAC name is 1-(4-benzhydrylpiperazin-1-yl)-3-[(6-methoxyimino-7,8-dihydro-5H-naphthalen-1-yl)oxy]propan-2-ol.
| Compound Name | 1-(4-benzhydrylpiperazin-1-yl)-3-[(6-methoxyimino-7,8-dihydro-5H-naphthalen-1-yl)oxy]propan-2-ol |
|---|---|
| PubChem CID | 54119037 |
| Molecular Formula | C31H37N3O3 |
| Molecular Weight | 499.66 g/mol |
| Exact Mass | 499.28 |
| IUPAC Name | 1-(4-benzhydrylpiperazin-1-yl)-3-[(6-methoxyimino-7,8-dihydro-5H-naphthalen-1-yl)oxy]propan-2-ol |
| SMILES | CON=C1CCc2c(cccc2OCC(O)CN2CCN(C(c3ccccc3)c3ccccc3)CC2)C1 |
| InChI | InChI=1S/C31H37N3O3/c1-36-32-27-15-16-29-26(21-27)13-8-14-30(29)37-23-28(35)22-33-17-19-34(20-18-33)31(24-9-4-2-5-10-24)25-11-6-3-7-12-25/h2-14,28,31,35H,15-23H2,1H3 |
| InChIKey | NMIOUNHILWXAAU-UHFFFAOYSA-N |
| XLogP | 4.32 |
| TPSA | 57.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 37 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 499.66 |
| LogP ≤ 5 | 4.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|