C17H29O5P — CID 54119752
3-(2-dodecyl-2-oxo-1,2λ5-oxaphosphiran-3-yl)-2-hydroxy-2H-furan-5-one (PubChem CID 54119752) has the molecular formula C17H29O5P and a molecular weight of 344.39 g/mol. Its IUPAC name is 3-(2-dodecyl-2-oxo-1,2λ5-oxaphosphiran-3-yl)-2-hydroxy-2H-furan-5-one.
| Compound Name | 3-(2-dodecyl-2-oxo-1,2λ5-oxaphosphiran-3-yl)-2-hydroxy-2H-furan-5-one |
|---|---|
| PubChem CID | 54119752 |
| Molecular Formula | C17H29O5P |
| Molecular Weight | 344.39 g/mol |
| Exact Mass | 344.18 |
| IUPAC Name | 3-(2-dodecyl-2-oxo-1,2λ5-oxaphosphiran-3-yl)-2-hydroxy-2H-furan-5-one |
| SMILES | CCCCCCCCCCCCP1(=O)OC1C1=CC(=O)OC1O |
| InChI | InChI=1S/C17H29O5P/c1-2-3-4-5-6-7-8-9-10-11-12-23(20)17(22-23)14-13-15(18)21-16(14)19/h13,16-17,19H,2-12H2,1H3 |
| InChIKey | NMUVFVNQPFHYGM-UHFFFAOYSA-N |
| XLogP | 4.34 |
| TPSA | 76.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.39 |
| LogP ≤ 5 | 4.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|