C19H32O4S — CID 86748445
O-[1-(2-hydroxy-5-oxo-2H-furan-3-yl)tridecyl] ethanethioate (PubChem CID 86748445) has the molecular formula C19H32O4S and a molecular weight of 356.53 g/mol. Its IUPAC name is O-[1-(2-hydroxy-5-oxo-2H-furan-3-yl)tridecyl] ethanethioate.
| Compound Name | O-[1-(2-hydroxy-5-oxo-2H-furan-3-yl)tridecyl] ethanethioate |
|---|---|
| PubChem CID | 86748445 |
| Molecular Formula | C19H32O4S |
| Molecular Weight | 356.53 g/mol |
| Exact Mass | 356.20 |
| IUPAC Name | O-[1-(2-hydroxy-5-oxo-2H-furan-3-yl)tridecyl] ethanethioate |
| SMILES | CCCCCCCCCCCCC(OC(C)=S)C1=CC(=O)OC1O |
| InChI | InChI=1S/C19H32O4S/c1-3-4-5-6-7-8-9-10-11-12-13-17(22-15(2)24)16-14-18(20)23-19(16)21/h14,17,19,21H,3-13H2,1-2H3 |
| InChIKey | AJMSJVJPHNGRGZ-UHFFFAOYSA-N |
| XLogP | 4.83 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.53 |
| LogP ≤ 5 | 4.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|