C20H23N3O4 — CID 54120846
3-[(2-aminophenyl)methyl]-5-(3,4-dimethoxyphenyl)-6-ethyl-6H-1,3,4-oxadiazin-2-one (PubChem CID 54120846) has the molecular formula C20H23N3O4 and a molecular weight of 369.42 g/mol. Its IUPAC name is 3-[(2-aminophenyl)methyl]-5-(3,4-dimethoxyphenyl)-6-ethyl-6H-1,3,4-oxadiazin-2-one.
| Compound Name | 3-[(2-aminophenyl)methyl]-5-(3,4-dimethoxyphenyl)-6-ethyl-6H-1,3,4-oxadiazin-2-one |
|---|---|
| PubChem CID | 54120846 |
| Molecular Formula | C20H23N3O4 |
| Molecular Weight | 369.42 g/mol |
| Exact Mass | 369.17 |
| IUPAC Name | 3-[(2-aminophenyl)methyl]-5-(3,4-dimethoxyphenyl)-6-ethyl-6H-1,3,4-oxadiazin-2-one |
| SMILES | CCC1OC(=O)N(Cc2ccccc2N)N=C1c1ccc(OC)c(OC)c1 |
| InChI | InChI=1S/C20H23N3O4/c1-4-16-19(13-9-10-17(25-2)18(11-13)26-3)22-23(20(24)27-16)12-14-7-5-6-8-15(14)21/h5-11,16H,4,12,21H2,1-3H3 |
| InChIKey | NNOXGWNVMOFEKT-UHFFFAOYSA-N |
| XLogP | 3.42 |
| TPSA | 86.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.42 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|