C21H29ClN4O2 — CID 54122103
2-(4-chlorophenyl)-4-cyclohexyl-4-methoxyimino-3,3-dimethyl-1-(1,2,4-triazol-1-yl)butan-2-ol (PubChem CID 54122103) has the molecular formula C21H29ClN4O2 and a molecular weight of 404.94 g/mol. Its IUPAC name is 2-(4-chlorophenyl)-4-cyclohexyl-4-methoxyimino-3,3-dimethyl-1-(1,2,4-triazol-1-yl)butan-2-ol.
| Compound Name | 2-(4-chlorophenyl)-4-cyclohexyl-4-methoxyimino-3,3-dimethyl-1-(1,2,4-triazol-1-yl)butan-2-ol |
|---|---|
| PubChem CID | 54122103 |
| Molecular Formula | C21H29ClN4O2 |
| Molecular Weight | 404.94 g/mol |
| Exact Mass | 404.20 |
| IUPAC Name | 2-(4-chlorophenyl)-4-cyclohexyl-4-methoxyimino-3,3-dimethyl-1-(1,2,4-triazol-1-yl)butan-2-ol |
| SMILES | CON=C(C1CCCCC1)C(C)(C)C(O)(Cn1cncn1)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C21H29ClN4O2/c1-20(2,19(25-28-3)16-7-5-4-6-8-16)21(27,13-26-15-23-14-24-26)17-9-11-18(22)12-10-17/h9-12,14-16,27H,4-8,13H2,1-3H3 |
| InChIKey | NOKVCIIOKNBWBC-UHFFFAOYSA-N |
| XLogP | 4.43 |
| TPSA | 72.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.94 |
| LogP ≤ 5 | 4.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|