C7H10F4N2O2 — CID 54123031
2,3-bis(difluoroamino)propyl 2-methylprop-2-enoate (PubChem CID 54123031) has the molecular formula C7H10F4N2O2 and a molecular weight of 230.16 g/mol. Its IUPAC name is 2,3-bis(difluoroamino)propyl 2-methylprop-2-enoate.
| Compound Name | 2,3-bis(difluoroamino)propyl 2-methylprop-2-enoate |
|---|---|
| PubChem CID | 54123031 |
| Molecular Formula | C7H10F4N2O2 |
| Molecular Weight | 230.16 g/mol |
| Exact Mass | 230.07 |
| IUPAC Name | 2,3-bis(difluoroamino)propyl 2-methylprop-2-enoate |
| SMILES | C=C(C)C(=O)OCC(CN(F)F)N(F)F |
| InChI | InChI=1S/C7H10F4N2O2/c1-5(2)7(14)15-4-6(13(10)11)3-12(8)9/h6H,1,3-4H2,2H3 |
| InChIKey | NPAVQWOAVPEWHM-UHFFFAOYSA-N |
| XLogP | 1.62 |
| TPSA | 32.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 230.16 |
| LogP ≤ 5 | 1.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'N-halo', 'substructure': 'N/A'} |
|---|