C16H19ClN4O2 — CID 5412429
2-(4-chlorophenoxy)-N-[(Z)-(1,3-dimethylpyrazol-4-yl)methylideneamino]-2-methylpropanamide (PubChem CID 5412429) has the molecular formula C16H19ClN4O2 and a molecular weight of 334.81 g/mol. Its IUPAC name is 2-(4-chlorophenoxy)-N-[(Z)-(1,3-dimethylpyrazol-4-yl)methylideneamino]-2-methylpropanamide.
| Compound Name | 2-(4-chlorophenoxy)-N-[(Z)-(1,3-dimethylpyrazol-4-yl)methylideneamino]-2-methylpropanamide |
|---|---|
| PubChem CID | 5412429 |
| Molecular Formula | C16H19ClN4O2 |
| Molecular Weight | 334.81 g/mol |
| Exact Mass | 334.12 |
| IUPAC Name | 2-(4-chlorophenoxy)-N-[(Z)-(1,3-dimethylpyrazol-4-yl)methylideneamino]-2-methylpropanamide |
| SMILES | Cc1nn(C)cc1/C=N\NC(=O)C(C)(C)Oc1ccc(Cl)cc1 |
| InChI | InChI=1S/C16H19ClN4O2/c1-11-12(10-21(4)20-11)9-18-19-15(22)16(2,3)23-14-7-5-13(17)6-8-14/h5-10H,1-4H3,(H,19,22)/b18-9- |
| InChIKey | AVUWXPTUBUDVBQ-NVMNQCDNSA-N |
| XLogP | 2.69 |
| TPSA | 68.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.81 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|