C18H18O5 — CID 54125547
2-(6,7-dimethoxy-3,4-dihydro-1H-isochromen-1-yl)benzoic acid (PubChem CID 54125547) has the molecular formula C18H18O5 and a molecular weight of 314.34 g/mol. Its IUPAC name is 2-(6,7-dimethoxy-3,4-dihydro-1H-isochromen-1-yl)benzoic acid.
| Compound Name | 2-(6,7-dimethoxy-3,4-dihydro-1H-isochromen-1-yl)benzoic acid |
|---|---|
| PubChem CID | 54125547 |
| Molecular Formula | C18H18O5 |
| Molecular Weight | 314.34 g/mol |
| Exact Mass | 314.12 |
| IUPAC Name | 2-(6,7-dimethoxy-3,4-dihydro-1H-isochromen-1-yl)benzoic acid |
| SMILES | COc1cc2c(cc1OC)C(c1ccccc1C(=O)O)OCC2 |
| InChI | InChI=1S/C18H18O5/c1-21-15-9-11-7-8-23-17(14(11)10-16(15)22-2)12-5-3-4-6-13(12)18(19)20/h3-6,9-10,17H,7-8H2,1-2H3,(H,19,20) |
| InChIKey | NQRZQYVZDOSQHQ-UHFFFAOYSA-N |
| XLogP | 3.06 |
| TPSA | 64.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.34 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |