About 3-[(1S)-6,7-dimethoxy-3,4-dihydro-1H-isochromen-1-yl]-9-methylcarbazole
3-[(1S)-6,7-dimethoxy-3,4-dihydro-1H-isochromen-1-yl]-9-methylcarbazole (PubChem CID 7328419) has the molecular formula C24H23NO3
and a molecular weight of 373.45 g/mol. Its IUPAC name is 3-[(1S)-6,7-dimethoxy-3,4-dihydro-1H-isochromen-1-yl]-9-methylcarbazole.
Molecular Properties
| Compound Name | 3-[(1S)-6,7-dimethoxy-3,4-dihydro-1H-isochromen-1-yl]-9-methylcarbazole |
| PubChem CID | 7328419 |
| Molecular Formula | C24H23NO3 |
| Molecular Weight | 373.45 g/mol |
| Exact Mass | 373.17 |
| IUPAC Name | 3-[(1S)-6,7-dimethoxy-3,4-dihydro-1H-isochromen-1-yl]-9-methylcarbazole |
| SMILES | COc1cc2c(cc1OC)[C@H](c1ccc3c(c1)c1ccccc1n3C)OCC2 |
| InChI | InChI=1S/C24H23NO3/c1-25-20-7-5-4-6-17(20)19-12-16(8-9-21(19)25)24-18-14-23(27-3)22(26-2)13-15(18)10-11-28-24/h4-9,12-14,24H,10-11H2,1-3H3/t24-/m0/s1 |
| InChIKey | NORUPASHEHOSCC-DEOSSOPVSA-N |
| XLogP | 5.01 |
| TPSA | 32.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 373.45 |
| LogP ≤ 5 | 5.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 3-[(1S)-6,7-dimethoxy-3,4-dihydro-1H-isochromen-1-yl]-9-methylcarbazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[(1S)-6,7-dimethoxy-3,4-dihydro-1H-isochromen-1-yl]-9-methylcarbazole?
The IUPAC name of 3-[(1S)-6,7-dimethoxy-3,4-dihydro-1H-isochromen-1-yl]-9-methylcarbazole (CID 7328419) is 3-[(1S)-6,7-dimethoxy-3,4-dihydro-1H-isochromen-1-yl]-9-methylcarbazole.
What is the SMILES notation for 3-[(1S)-6,7-dimethoxy-3,4-dihydro-1H-isochromen-1-yl]-9-methylcarbazole?
The canonical SMILES for 3-[(1S)-6,7-dimethoxy-3,4-dihydro-1H-isochromen-1-yl]-9-methylcarbazole is COc1cc2c(cc1OC)[C@H](c1ccc3c(c1)c1ccccc1n3C)OCC2.
What is the InChIKey of 3-[(1S)-6,7-dimethoxy-3,4-dihydro-1H-isochromen-1-yl]-9-methylcarbazole?
The InChIKey is NORUPASHEHOSCC-DEOSSOPVSA-N. The full InChI is InChI=1S/C24H23NO3/c1-25-20-7-5-4-6-17(20)19-12-16(8-9-21(19)25)24-18-14-23(27-3)22(26-2)13-15(18)10-11-28-24/h4-9,12-14,24H,10-11H2,1-3H3/t24-/m0/s1.
What are the key properties of 3-[(1S)-6,7-dimethoxy-3,4-dihydro-1H-isochromen-1-yl]-9-methylcarbazole?
3-[(1S)-6,7-dimethoxy-3,4-dihydro-1H-isochromen-1-yl]-9-methylcarbazole has a molecular weight of 373.45 g/mol, XLogP of 5.01, 3 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[(1S)-6,7-dimethoxy-3,4-dihydro-1H-isochromen-1-yl]-9-methylcarbazole is sourced from PubChem (CID 7328419), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).