C17H18NO5- — CID 163172007
N-[2-(6,7-dimethoxy-3,4-dihydro-1H-isochromen-1-yl)phenyl]-N-oxidohydroxylamine (PubChem CID 163172007) has the molecular formula C17H18NO5- and a molecular weight of 316.33 g/mol. Its IUPAC name is N-[2-(6,7-dimethoxy-3,4-dihydro-1H-isochromen-1-yl)phenyl]-N-oxidohydroxylamine.
| Compound Name | N-[2-(6,7-dimethoxy-3,4-dihydro-1H-isochromen-1-yl)phenyl]-N-oxidohydroxylamine |
|---|---|
| PubChem CID | 163172007 |
| Molecular Formula | C17H18NO5- |
| Molecular Weight | 316.33 g/mol |
| Exact Mass | 316.12 |
| IUPAC Name | N-[2-(6,7-dimethoxy-3,4-dihydro-1H-isochromen-1-yl)phenyl]-N-oxidohydroxylamine |
| SMILES | COc1cc2c(cc1OC)C(c1ccccc1N([O-])O)OCC2 |
| InChI | InChI=1S/C17H18NO5/c1-21-15-9-11-7-8-23-17(13(11)10-16(15)22-2)12-5-3-4-6-14(12)18(19)20/h3-6,9-10,17,19H,7-8H2,1-2H3/q-1 |
| InChIKey | SKIPCVAQSWPSNK-UHFFFAOYSA-N |
| XLogP | 3.06 |
| TPSA | 74.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.33 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|