C44H33N5 — CID 54127643
4-(10,15,20-triphenyl-21,22,23,24-tetrahydroporphyrin-5-yl)aniline (PubChem CID 54127643) has the molecular formula C44H33N5 and a molecular weight of 631.78 g/mol. Its IUPAC name is 4-(10,15,20-triphenyl-21,22,23,24-tetrahydroporphyrin-5-yl)aniline.
| Compound Name | 4-(10,15,20-triphenyl-21,22,23,24-tetrahydroporphyrin-5-yl)aniline |
|---|---|
| PubChem CID | 54127643 |
| Molecular Formula | C44H33N5 |
| Molecular Weight | 631.78 g/mol |
| Exact Mass | 631.27 |
| IUPAC Name | 4-(10,15,20-triphenyl-21,22,23,24-tetrahydroporphyrin-5-yl)aniline |
| SMILES | Nc1ccc(C2=c3ccc([nH]3)=C(c3ccccc3)c3ccc([nH]3)C(c3ccccc3)=c3ccc([nH]3)=C(c3ccccc3)c3ccc2[nH]3)cc1 |
| InChI | InChI=1S/C44H33N5/c45-32-18-16-31(17-19-32)44-39-26-24-37(48-39)42(29-12-6-2-7-13-29)35-22-20-33(46-35)41(28-10-4-1-5-11-28)34-21-23-36(47-34)43(30-14-8-3-9-15-30)38-25-27-40(44)49-38/h1-27,46-49H,45H2 |
| InChIKey | FCFHIZVHVPPECZ-UHFFFAOYSA-N |
| XLogP | 5.88 |
| TPSA | 89.18 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 631.78 |
| LogP ≤ 5 | 5.88 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|