C18H18ClFN4O4 — CID 54128570
4-[3-(aminomethyl)-4-chloropyrrolidin-1-yl]-3-fluoro-8-methyl-6,11-dioxa-9,12-diazatetracyclo[7.6.1.05,16.010,14]hexadeca-1,3,5(16),10(14)-tetraene-13,15-dione (PubChem CID 54128570) has the molecular formula C18H18ClFN4O4 and a molecular weight of 408.82 g/mol. Its IUPAC name is 4-[3-(aminomethyl)-4-chloropyrrolidin-1-yl]-3-fluoro-8-methyl-6,11-dioxa-9,12-diazatetracyclo[7.6.1.05,16.010,14]hexadeca-1,3,5(16),10(14)-tetraene-13,15-dione.
| Compound Name | 4-[3-(aminomethyl)-4-chloropyrrolidin-1-yl]-3-fluoro-8-methyl-6,11-dioxa-9,12-diazatetracyclo[7.6.1.05,16.010,14]hexadeca-1,3,5(16),10(14)-tetraene-13,15-dione |
|---|---|
| PubChem CID | 54128570 |
| Molecular Formula | C18H18ClFN4O4 |
| Molecular Weight | 408.82 g/mol |
| Exact Mass | 408.10 |
| IUPAC Name | 4-[3-(aminomethyl)-4-chloropyrrolidin-1-yl]-3-fluoro-8-methyl-6,11-dioxa-9,12-diazatetracyclo[7.6.1.05,16.010,14]hexadeca-1,3,5(16),10(14)-tetraene-13,15-dione |
| SMILES | CC1COc2c(N3CC(Cl)C(CN)C3)c(F)cc3c(=O)c4c(=O)[nH]oc4n1c23 |
| InChI | InChI=1S/C18H18ClFN4O4/c1-7-6-27-16-13-9(15(25)12-17(26)22-28-18(12)24(7)13)2-11(20)14(16)23-4-8(3-21)10(19)5-23/h2,7-8,10H,3-6,21H2,1H3,(H,22,26) |
| InChIKey | NSRMZCPPCQTBQL-UHFFFAOYSA-N |
| XLogP | 1.53 |
| TPSA | 106.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.82 |
| LogP ≤ 5 | 1.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|