C17H15FN4O4S — CID 173123786
(8S)-3-fluoro-4-(3-hydroxyiminopyrrolidin-1-yl)-8-methyl-6-oxa-11-thia-9,12-diazatetracyclo[7.6.1.05,16.010,14]hexadeca-1,3,5(16),10(14)-tetraene-13,15-dione (PubChem CID 173123786) has the molecular formula C17H15FN4O4S and a molecular weight of 390.40 g/mol. Its IUPAC name is (8S)-3-fluoro-4-(3-hydroxyiminopyrrolidin-1-yl)-8-methyl-6-oxa-11-thia-9,12-diazatetracyclo[7.6.1.05,16.010,14]hexadeca-1,3,5(16),10(14)-tetraene-13,15-dione.
| Compound Name | (8S)-3-fluoro-4-(3-hydroxyiminopyrrolidin-1-yl)-8-methyl-6-oxa-11-thia-9,12-diazatetracyclo[7.6.1.05,16.010,14]hexadeca-1,3,5(16),10(14)-tetraene-13,15-dione |
|---|---|
| PubChem CID | 173123786 |
| Molecular Formula | C17H15FN4O4S |
| Molecular Weight | 390.40 g/mol |
| Exact Mass | 390.08 |
| IUPAC Name | (8S)-3-fluoro-4-(3-hydroxyiminopyrrolidin-1-yl)-8-methyl-6-oxa-11-thia-9,12-diazatetracyclo[7.6.1.05,16.010,14]hexadeca-1,3,5(16),10(14)-tetraene-13,15-dione |
| SMILES | C[C@H]1COc2c(N3CCC(=NO)C3)c(F)cc3c(=O)c4c(=O)[nH]sc4n1c23 |
| InChI | InChI=1S/C17H15FN4O4S/c1-7-6-26-15-12-9(14(23)11-16(24)20-27-17(11)22(7)12)4-10(18)13(15)21-3-2-8(5-21)19-25/h4,7,25H,2-3,5-6H2,1H3,(H,20,24)/t7-/m0/s1 |
| InChIKey | TZIZODTXCQDENG-ZETCQYMHSA-N |
| XLogP | 2.04 |
| TPSA | 99.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.40 |
| LogP ≤ 5 | 2.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|