About chloromethyl 2-(diethylamino)ethyl carbonate
chloromethyl 2-(diethylamino)ethyl carbonate (PubChem CID 54133141) has the molecular formula C8H16ClNO3
and a molecular weight of 209.67 g/mol. Its IUPAC name is chloromethyl 2-(diethylamino)ethyl carbonate.
Molecular Properties
| Compound Name | chloromethyl 2-(diethylamino)ethyl carbonate |
| PubChem CID | 54133141 |
| Molecular Formula | C8H16ClNO3 |
| Molecular Weight | 209.67 g/mol |
| Exact Mass | 209.08 |
| IUPAC Name | chloromethyl 2-(diethylamino)ethyl carbonate |
| SMILES | CCN(CC)CCOC(=O)OCCl |
| InChI | InChI=1S/C8H16ClNO3/c1-3-10(4-2)5-6-12-8(11)13-7-9/h3-7H2,1-2H3 |
| InChIKey | NVTONDIAKHAZBF-UHFFFAOYSA-N |
| XLogP | 1.68 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 209.67 |
| LogP ≤ 5 | 1.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze chloromethyl 2-(diethylamino)ethyl carbonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of chloromethyl 2-(diethylamino)ethyl carbonate?
The IUPAC name of chloromethyl 2-(diethylamino)ethyl carbonate (CID 54133141) is chloromethyl 2-(diethylamino)ethyl carbonate.
What is the SMILES notation for chloromethyl 2-(diethylamino)ethyl carbonate?
The canonical SMILES for chloromethyl 2-(diethylamino)ethyl carbonate is CCN(CC)CCOC(=O)OCCl.
What is the InChIKey of chloromethyl 2-(diethylamino)ethyl carbonate?
The InChIKey is NVTONDIAKHAZBF-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H16ClNO3/c1-3-10(4-2)5-6-12-8(11)13-7-9/h3-7H2,1-2H3.
What are the key properties of chloromethyl 2-(diethylamino)ethyl carbonate?
chloromethyl 2-(diethylamino)ethyl carbonate has a molecular weight of 209.67 g/mol, XLogP of 1.68, 6 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for chloromethyl 2-(diethylamino)ethyl carbonate is sourced from PubChem (CID 54133141), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).