About 2-[2-chloroethyl(ethyl)amino]ethyl acetate;iodomethane
2-[2-chloroethyl(ethyl)amino]ethyl acetate;iodomethane (PubChem CID 159717423) has the molecular formula C9H19ClINO2
and a molecular weight of 335.61 g/mol. Its IUPAC name is 2-[2-chloroethyl(ethyl)amino]ethyl acetate;iodomethane.
Molecular Properties
| Compound Name | 2-[2-chloroethyl(ethyl)amino]ethyl acetate;iodomethane |
| PubChem CID | 159717423 |
| Molecular Formula | C9H19ClINO2 |
| Molecular Weight | 335.61 g/mol |
| Exact Mass | 335.01 |
| IUPAC Name | 2-[2-chloroethyl(ethyl)amino]ethyl acetate;iodomethane |
| SMILES | CCN(CCCl)CCOC(C)=O.CI |
| InChI | InChI=1S/C8H16ClNO2.CH3I/c1-3-10(5-4-9)6-7-12-8(2)11;1-2/h3-7H2,1-2H3;1H3 |
| InChIKey | MZPKQFBGMQBQGE-UHFFFAOYSA-N |
| XLogP | 2.16 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 335.61 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|
Analyze 2-[2-chloroethyl(ethyl)amino]ethyl acetate;iodomethane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[2-chloroethyl(ethyl)amino]ethyl acetate;iodomethane?
The IUPAC name of 2-[2-chloroethyl(ethyl)amino]ethyl acetate;iodomethane (CID 159717423) is 2-[2-chloroethyl(ethyl)amino]ethyl acetate;iodomethane.
What is the SMILES notation for 2-[2-chloroethyl(ethyl)amino]ethyl acetate;iodomethane?
The canonical SMILES for 2-[2-chloroethyl(ethyl)amino]ethyl acetate;iodomethane is CCN(CCCl)CCOC(C)=O.CI.
What is the InChIKey of 2-[2-chloroethyl(ethyl)amino]ethyl acetate;iodomethane?
The InChIKey is MZPKQFBGMQBQGE-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H16ClNO2.CH3I/c1-3-10(5-4-9)6-7-12-8(2)11;1-2/h3-7H2,1-2H3;1H3.
What are the key properties of 2-[2-chloroethyl(ethyl)amino]ethyl acetate;iodomethane?
2-[2-chloroethyl(ethyl)amino]ethyl acetate;iodomethane has a molecular weight of 335.61 g/mol, XLogP of 2.16, 6 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[2-chloroethyl(ethyl)amino]ethyl acetate;iodomethane is sourced from PubChem (CID 159717423), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).