C17H19F5S — CID 54134120
pentafluoro-[4-[2-(4-propylphenyl)ethyl]phenyl]-λ6-sulfane (PubChem CID 54134120) has the molecular formula C17H19F5S and a molecular weight of 350.40 g/mol. Its IUPAC name is pentafluoro-[4-[2-(4-propylphenyl)ethyl]phenyl]-λ6-sulfane.
| Compound Name | pentafluoro-[4-[2-(4-propylphenyl)ethyl]phenyl]-λ6-sulfane |
|---|---|
| PubChem CID | 54134120 |
| Molecular Formula | C17H19F5S |
| Molecular Weight | 350.40 g/mol |
| Exact Mass | 350.11 |
| IUPAC Name | pentafluoro-[4-[2-(4-propylphenyl)ethyl]phenyl]-λ6-sulfane |
| SMILES | CCCc1ccc(CCc2ccc(S(F)(F)(F)(F)F)cc2)cc1 |
| InChI | InChI=1S/C17H19F5S/c1-2-3-14-4-6-15(7-5-14)8-9-16-10-12-17(13-11-16)23(18,19,20,21)22/h4-7,10-13H,2-3,8-9H2,1H3 |
| InChIKey | NWLKWQAGGDMOCW-UHFFFAOYSA-N |
| XLogP | 7.08 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.40 |
| LogP ≤ 5 | 7.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |