C18H14N2 — CID 54134698
5,9-diazapentacyclo[10.8.0.03,10.04,8.013,18]icosa-1,3(10),4(8),11,13,15,17,19-octaene (PubChem CID 54134698) has the molecular formula C18H14N2 and a molecular weight of 258.32 g/mol. Its IUPAC name is 5,9-diazapentacyclo[10.8.0.03,10.04,8.013,18]icosa-1,3(10),4(8),11,13,15,17,19-octaene.
| Compound Name | 5,9-diazapentacyclo[10.8.0.03,10.04,8.013,18]icosa-1,3(10),4(8),11,13,15,17,19-octaene |
|---|---|
| PubChem CID | 54134698 |
| Molecular Formula | C18H14N2 |
| Molecular Weight | 258.32 g/mol |
| Exact Mass | 258.12 |
| IUPAC Name | 5,9-diazapentacyclo[10.8.0.03,10.04,8.013,18]icosa-1,3(10),4(8),11,13,15,17,19-octaene |
| SMILES | c1ccc2c(c1)ccc1cc3c4c([nH]c3cc12)CCN4 |
| InChI | InChI=1S/C18H14N2/c1-2-4-13-11(3-1)5-6-12-9-15-17(10-14(12)13)20-16-7-8-19-18(15)16/h1-6,9-10,19-20H,7-8H2 |
| InChIKey | NWVUBXGNCBSOPZ-UHFFFAOYSA-N |
| XLogP | 4.44 |
| TPSA | 27.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.32 |
| LogP ≤ 5 | 4.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|