C20H27NO4S2 — CID 54135951
methyl 2-[5-[[(4-butylphenyl)methyl-methylsulfonylamino]methyl]thiophen-2-yl]acetate (PubChem CID 54135951) has the molecular formula C20H27NO4S2 and a molecular weight of 409.57 g/mol. Its IUPAC name is methyl 2-[5-[[(4-butylphenyl)methyl-methylsulfonylamino]methyl]thiophen-2-yl]acetate.
| Compound Name | methyl 2-[5-[[(4-butylphenyl)methyl-methylsulfonylamino]methyl]thiophen-2-yl]acetate |
|---|---|
| PubChem CID | 54135951 |
| Molecular Formula | C20H27NO4S2 |
| Molecular Weight | 409.57 g/mol |
| Exact Mass | 409.14 |
| IUPAC Name | methyl 2-[5-[[(4-butylphenyl)methyl-methylsulfonylamino]methyl]thiophen-2-yl]acetate |
| SMILES | CCCCc1ccc(CN(Cc2ccc(CC(=O)OC)s2)S(C)(=O)=O)cc1 |
| InChI | InChI=1S/C20H27NO4S2/c1-4-5-6-16-7-9-17(10-8-16)14-21(27(3,23)24)15-19-12-11-18(26-19)13-20(22)25-2/h7-12H,4-6,13-15H2,1-3H3 |
| InChIKey | NXSBJUVBALGUPS-UHFFFAOYSA-N |
| XLogP | 3.77 |
| TPSA | 63.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.57 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |