About diethyl 6-methoxyimino-4-oxo-10-propylpyrano[3,2-g]chromene-2,8-dicarboxylate
diethyl 6-methoxyimino-4-oxo-10-propylpyrano[3,2-g]chromene-2,8-dicarboxylate (PubChem CID 54137318) has the molecular formula C22H23NO8
and a molecular weight of 429.43 g/mol. Its IUPAC name is diethyl 6-methoxyimino-4-oxo-10-propylpyrano[3,2-g]chromene-2,8-dicarboxylate.
Molecular Properties
| Compound Name | diethyl 6-methoxyimino-4-oxo-10-propylpyrano[3,2-g]chromene-2,8-dicarboxylate |
| PubChem CID | 54137318 |
| Molecular Formula | C22H23NO8 |
| Molecular Weight | 429.43 g/mol |
| Exact Mass | 429.14 |
| IUPAC Name | diethyl 6-methoxyimino-4-oxo-10-propylpyrano[3,2-g]chromene-2,8-dicarboxylate |
| SMILES | CCCc1c2oc(C(=O)OCC)cc(=O)c2cc2c(=NOC)cc(C(=O)OCC)oc12 |
| InChI | InChI=1S/C22H23NO8/c1-5-8-12-19-13(15(23-27-4)10-17(30-19)21(25)28-6-2)9-14-16(24)11-18(31-20(12)14)22(26)29-7-3/h9-11H,5-8H2,1-4H3 |
| InChIKey | NYQBSYKMSACXNN-UHFFFAOYSA-N |
| XLogP | 3.31 |
| TPSA | 117.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 429.43 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|
Analyze diethyl 6-methoxyimino-4-oxo-10-propylpyrano[3,2-g]chromene-2,8-dicarboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of diethyl 6-methoxyimino-4-oxo-10-propylpyrano[3,2-g]chromene-2,8-dicarboxylate?
The IUPAC name of diethyl 6-methoxyimino-4-oxo-10-propylpyrano[3,2-g]chromene-2,8-dicarboxylate (CID 54137318) is diethyl 6-methoxyimino-4-oxo-10-propylpyrano[3,2-g]chromene-2,8-dicarboxylate.
What is the SMILES notation for diethyl 6-methoxyimino-4-oxo-10-propylpyrano[3,2-g]chromene-2,8-dicarboxylate?
The canonical SMILES for diethyl 6-methoxyimino-4-oxo-10-propylpyrano[3,2-g]chromene-2,8-dicarboxylate is CCCc1c2oc(C(=O)OCC)cc(=O)c2cc2c(=NOC)cc(C(=O)OCC)oc12.
What is the InChIKey of diethyl 6-methoxyimino-4-oxo-10-propylpyrano[3,2-g]chromene-2,8-dicarboxylate?
The InChIKey is NYQBSYKMSACXNN-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H23NO8/c1-5-8-12-19-13(15(23-27-4)10-17(30-19)21(25)28-6-2)9-14-16(24)11-18(31-20(12)14)22(26)29-7-3/h9-11H,5-8H2,1-4H3.
What are the key properties of diethyl 6-methoxyimino-4-oxo-10-propylpyrano[3,2-g]chromene-2,8-dicarboxylate?
diethyl 6-methoxyimino-4-oxo-10-propylpyrano[3,2-g]chromene-2,8-dicarboxylate has a molecular weight of 429.43 g/mol, XLogP of 3.31, 7 rotatable bonds, 0 hydrogen bond donors, and 9 hydrogen bond acceptors.
Where does this data come from?
All data for diethyl 6-methoxyimino-4-oxo-10-propylpyrano[3,2-g]chromene-2,8-dicarboxylate is sourced from PubChem (CID 54137318), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).