C22H23NO8 — CID 54137318
diethyl 6-methoxyimino-4-oxo-10-propylpyrano[3,2-g]chromene-2,8-dicarboxylate (PubChem CID 54137318) has the molecular formula C22H23NO8 and a molecular weight of 429.43 g/mol. Its IUPAC name is diethyl 6-methoxyimino-4-oxo-10-propylpyrano[3,2-g]chromene-2,8-dicarboxylate.
| Compound Name | diethyl 6-methoxyimino-4-oxo-10-propylpyrano[3,2-g]chromene-2,8-dicarboxylate |
|---|---|
| PubChem CID | 54137318 |
| Molecular Formula | C22H23NO8 |
| Molecular Weight | 429.43 g/mol |
| Exact Mass | 429.14 |
| IUPAC Name | diethyl 6-methoxyimino-4-oxo-10-propylpyrano[3,2-g]chromene-2,8-dicarboxylate |
| SMILES | CCCc1c2oc(C(=O)OCC)cc(=O)c2cc2c(=NOC)cc(C(=O)OCC)oc12 |
| InChI | InChI=1S/C22H23NO8/c1-5-8-12-19-13(15(23-27-4)10-17(30-19)21(25)28-6-2)9-14-16(24)11-18(31-20(12)14)22(26)29-7-3/h9-11H,5-8H2,1-4H3 |
| InChIKey | NYQBSYKMSACXNN-UHFFFAOYSA-N |
| XLogP | 3.31 |
| TPSA | 117.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.43 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|