C13H15N3O3 — CID 5413777
[(Z)-[cyclopropyl(2,3-dihydro-1,4-benzodioxin-6-yl)methylidene]amino]urea (PubChem CID 5413777) has the molecular formula C13H15N3O3 and a molecular weight of 261.28 g/mol. Its IUPAC name is [(Z)-[cyclopropyl(2,3-dihydro-1,4-benzodioxin-6-yl)methylidene]amino]urea.
| Compound Name | [(Z)-[cyclopropyl(2,3-dihydro-1,4-benzodioxin-6-yl)methylidene]amino]urea |
|---|---|
| PubChem CID | 5413777 |
| Molecular Formula | C13H15N3O3 |
| Molecular Weight | 261.28 g/mol |
| Exact Mass | 261.11 |
| IUPAC Name | [(Z)-[cyclopropyl(2,3-dihydro-1,4-benzodioxin-6-yl)methylidene]amino]urea |
| SMILES | NC(=O)N/N=C(\c1ccc2c(c1)OCCO2)C1CC1 |
| InChI | InChI=1S/C13H15N3O3/c14-13(17)16-15-12(8-1-2-8)9-3-4-10-11(7-9)19-6-5-18-10/h3-4,7-8H,1-2,5-6H2,(H3,14,16,17)/b15-12- |
| InChIKey | IVEVOIJHTQKILG-QINSGFPZSA-N |
| XLogP | 1.24 |
| TPSA | 85.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.28 |
| LogP ≤ 5 | 1.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|