C17H30N2O3 — CID 54139119
ethyl 4-amino-3-pentan-3-yloxy-5-(prop-2-enylamino)cyclohexene-1-carboxylate (PubChem CID 54139119) has the molecular formula C17H30N2O3 and a molecular weight of 310.44 g/mol. Its IUPAC name is ethyl 4-amino-3-pentan-3-yloxy-5-(prop-2-enylamino)cyclohexene-1-carboxylate.
| Compound Name | ethyl 4-amino-3-pentan-3-yloxy-5-(prop-2-enylamino)cyclohexene-1-carboxylate |
|---|---|
| PubChem CID | 54139119 |
| Molecular Formula | C17H30N2O3 |
| Molecular Weight | 310.44 g/mol |
| Exact Mass | 310.23 |
| IUPAC Name | ethyl 4-amino-3-pentan-3-yloxy-5-(prop-2-enylamino)cyclohexene-1-carboxylate |
| SMILES | C=CCNC1CC(C(=O)OCC)=CC(OC(CC)CC)C1N |
| InChI | InChI=1S/C17H30N2O3/c1-5-9-19-14-10-12(17(20)21-8-4)11-15(16(14)18)22-13(6-2)7-3/h5,11,13-16,19H,1,6-10,18H2,2-4H3 |
| InChIKey | NZVGOOXTMRCQRY-UHFFFAOYSA-N |
| XLogP | 1.92 |
| TPSA | 73.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.44 |
| LogP ≤ 5 | 1.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|