C17H26N2O7 — CID 54140544
(2R)-1-[2-[bis(carboxymethyl)amino]acetyl]-2-cyclohexylpyrrolidine-2-carboxylic acid (PubChem CID 54140544) has the molecular formula C17H26N2O7 and a molecular weight of 370.40 g/mol. Its IUPAC name is (2R)-1-[2-[bis(carboxymethyl)amino]acetyl]-2-cyclohexylpyrrolidine-2-carboxylic acid.
| Compound Name | (2R)-1-[2-[bis(carboxymethyl)amino]acetyl]-2-cyclohexylpyrrolidine-2-carboxylic acid |
|---|---|
| PubChem CID | 54140544 |
| Molecular Formula | C17H26N2O7 |
| Molecular Weight | 370.40 g/mol |
| Exact Mass | 370.17 |
| IUPAC Name | (2R)-1-[2-[bis(carboxymethyl)amino]acetyl]-2-cyclohexylpyrrolidine-2-carboxylic acid |
| SMILES | O=C(O)CN(CC(=O)O)CC(=O)N1CCC[C@]1(C(=O)O)C1CCCCC1 |
| InChI | InChI=1S/C17H26N2O7/c20-13(9-18(10-14(21)22)11-15(23)24)19-8-4-7-17(19,16(25)26)12-5-2-1-3-6-12/h12H,1-11H2,(H,21,22)(H,23,24)(H,25,26)/t17-/m1/s1 |
| InChIKey | OATXLQWHQALLRS-QGZVFWFLSA-N |
| XLogP | 0.48 |
| TPSA | 135.45 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.40 |
| LogP ≤ 5 | 0.48 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |