About 2-[(4-fluorophenyl)methyl-methylamino]ethyl 3-iminobutanoate
2-[(4-fluorophenyl)methyl-methylamino]ethyl 3-iminobutanoate (PubChem CID 54141493) has the molecular formula C14H19FN2O2
and a molecular weight of 266.32 g/mol. Its IUPAC name is 2-[(4-fluorophenyl)methyl-methylamino]ethyl 3-iminobutanoate.
Molecular Properties
| Compound Name | 2-[(4-fluorophenyl)methyl-methylamino]ethyl 3-iminobutanoate |
| PubChem CID | 54141493 |
| Molecular Formula | C14H19FN2O2 |
| Molecular Weight | 266.32 g/mol |
| Exact Mass | 266.14 |
| IUPAC Name | 2-[(4-fluorophenyl)methyl-methylamino]ethyl 3-iminobutanoate |
| SMILES | [H]/N=C(\C)CC(=O)OCCN(C)Cc1ccc(F)cc1 |
| InChI | InChI=1S/C14H19FN2O2/c1-11(16)9-14(18)19-8-7-17(2)10-12-3-5-13(15)6-4-12/h3-6,16H,7-10H2,1-2H3/b16-11+ |
| InChIKey | OBKKDAZQHIHELZ-LFIBNONCSA-N |
| XLogP | 2.23 |
| TPSA | 53.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 266.32 |
| LogP ≤ 5 | 2.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze 2-[(4-fluorophenyl)methyl-methylamino]ethyl 3-iminobutanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[(4-fluorophenyl)methyl-methylamino]ethyl 3-iminobutanoate?
The IUPAC name of 2-[(4-fluorophenyl)methyl-methylamino]ethyl 3-iminobutanoate (CID 54141493) is 2-[(4-fluorophenyl)methyl-methylamino]ethyl 3-iminobutanoate.
What is the SMILES notation for 2-[(4-fluorophenyl)methyl-methylamino]ethyl 3-iminobutanoate?
The canonical SMILES for 2-[(4-fluorophenyl)methyl-methylamino]ethyl 3-iminobutanoate is [H]/N=C(\C)CC(=O)OCCN(C)Cc1ccc(F)cc1.
What is the InChIKey of 2-[(4-fluorophenyl)methyl-methylamino]ethyl 3-iminobutanoate?
The InChIKey is OBKKDAZQHIHELZ-LFIBNONCSA-N. The full InChI is InChI=1S/C14H19FN2O2/c1-11(16)9-14(18)19-8-7-17(2)10-12-3-5-13(15)6-4-12/h3-6,16H,7-10H2,1-2H3/b16-11+.
What are the key properties of 2-[(4-fluorophenyl)methyl-methylamino]ethyl 3-iminobutanoate?
2-[(4-fluorophenyl)methyl-methylamino]ethyl 3-iminobutanoate has a molecular weight of 266.32 g/mol, XLogP of 2.23, 7 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[(4-fluorophenyl)methyl-methylamino]ethyl 3-iminobutanoate is sourced from PubChem (CID 54141493), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).