C12H16O4S2 — CID 54141824
3-propanoyl-1-oxa-8,11-dithiaspiro[5.6]dodecane-2,4-dione (PubChem CID 54141824) has the molecular formula C12H16O4S2 and a molecular weight of 288.39 g/mol. Its IUPAC name is 3-propanoyl-1-oxa-8,11-dithiaspiro[5.6]dodecane-2,4-dione.
| Compound Name | 3-propanoyl-1-oxa-8,11-dithiaspiro[5.6]dodecane-2,4-dione |
|---|---|
| PubChem CID | 54141824 |
| Molecular Formula | C12H16O4S2 |
| Molecular Weight | 288.39 g/mol |
| Exact Mass | 288.05 |
| IUPAC Name | 3-propanoyl-1-oxa-8,11-dithiaspiro[5.6]dodecane-2,4-dione |
| SMILES | CCC(=O)C1C(=O)CC2(CSCCSC2)OC1=O |
| InChI | InChI=1S/C12H16O4S2/c1-2-8(13)10-9(14)5-12(16-11(10)15)6-17-3-4-18-7-12/h10H,2-7H2,1H3 |
| InChIKey | OBPYWANNENEXFY-UHFFFAOYSA-N |
| XLogP | 1.32 |
| TPSA | 60.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.39 |
| LogP ≤ 5 | 1.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|